C11H18N4O3S — CID 173453248
prop-2-enyl N'-(dimethylcarbamoyl)-N-(prop-2-enylsulfanylcarbamoyl)carbamimidate (PubChem CID 173453248) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is prop-2-enyl N'-(dimethylcarbamoyl)-N-(prop-2-enylsulfanylcarbamoyl)carbamimidate.
| Compound Name | prop-2-enyl N'-(dimethylcarbamoyl)-N-(prop-2-enylsulfanylcarbamoyl)carbamimidate |
|---|---|
| PubChem CID | 173453248 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | prop-2-enyl N'-(dimethylcarbamoyl)-N-(prop-2-enylsulfanylcarbamoyl)carbamimidate |
| SMILES | C=CCOC(=NC(=O)N(C)C)NC(=O)NSCC=C |
| InChI | InChI=1S/C11H18N4O3S/c1-5-7-18-10(13-11(17)15(3)4)12-9(16)14-19-8-6-2/h5-6H,1-2,7-8H2,3-4H3,(H2,12,13,14,16,17) |
| InChIKey | YGWPMGHEEXSWQR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|