About ethyl N-[bis(methylsulfanyl)carbamoyl]-N'-(dimethylcarbamoyl)carbamimidate
ethyl N-[bis(methylsulfanyl)carbamoyl]-N'-(dimethylcarbamoyl)carbamimidate (PubChem CID 173453323) has the molecular formula C9H18N4O3S2
and a molecular weight of 294.40 g/mol. Its IUPAC name is ethyl N-[bis(methylsulfanyl)carbamoyl]-N'-(dimethylcarbamoyl)carbamimidate.
Molecular Properties
| Compound Name | ethyl N-[bis(methylsulfanyl)carbamoyl]-N'-(dimethylcarbamoyl)carbamimidate |
| PubChem CID | 173453323 |
| Molecular Formula | C9H18N4O3S2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | ethyl N-[bis(methylsulfanyl)carbamoyl]-N'-(dimethylcarbamoyl)carbamimidate |
| SMILES | CCOC(=NC(=O)N(C)C)NC(=O)N(SC)SC |
| InChI | InChI=1S/C9H18N4O3S2/c1-6-16-7(10-8(14)12(2)3)11-9(15)13(17-4)18-5/h6H2,1-5H3,(H,10,11,14,15) |
| InChIKey | KXCLKSJVZABBKF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[bis(methylsulfanyl)carbamoyl]-N'-(dimethylcarbamoyl)carbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[bis(methylsulfanyl)carbamoyl]-N'-(dimethylcarbamoyl)carbamimidate?
The IUPAC name of ethyl N-[bis(methylsulfanyl)carbamoyl]-N'-(dimethylcarbamoyl)carbamimidate (CID 173453323) is ethyl N-[bis(methylsulfanyl)carbamoyl]-N'-(dimethylcarbamoyl)carbamimidate.
What is the SMILES notation for ethyl N-[bis(methylsulfanyl)carbamoyl]-N'-(dimethylcarbamoyl)carbamimidate?
The canonical SMILES for ethyl N-[bis(methylsulfanyl)carbamoyl]-N'-(dimethylcarbamoyl)carbamimidate is CCOC(=NC(=O)N(C)C)NC(=O)N(SC)SC.
What is the InChIKey of ethyl N-[bis(methylsulfanyl)carbamoyl]-N'-(dimethylcarbamoyl)carbamimidate?
The InChIKey is KXCLKSJVZABBKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4O3S2/c1-6-16-7(10-8(14)12(2)3)11-9(15)13(17-4)18-5/h6H2,1-5H3,(H,10,11,14,15).
What are the key properties of ethyl N-[bis(methylsulfanyl)carbamoyl]-N'-(dimethylcarbamoyl)carbamimidate?
ethyl N-[bis(methylsulfanyl)carbamoyl]-N'-(dimethylcarbamoyl)carbamimidate has a molecular weight of 294.40 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[bis(methylsulfanyl)carbamoyl]-N'-(dimethylcarbamoyl)carbamimidate is sourced from PubChem (CID 173453323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).