C11H22N4O3 — CID 54202801
ethyl N-(tert-butylcarbamoyl)-N'-(dimethylcarbamoyl)carbamimidate (PubChem CID 54202801) has the molecular formula C11H22N4O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is ethyl N-(tert-butylcarbamoyl)-N'-(dimethylcarbamoyl)carbamimidate.
| Compound Name | ethyl N-(tert-butylcarbamoyl)-N'-(dimethylcarbamoyl)carbamimidate |
|---|---|
| PubChem CID | 54202801 |
| Molecular Formula | C11H22N4O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | ethyl N-(tert-butylcarbamoyl)-N'-(dimethylcarbamoyl)carbamimidate |
| SMILES | CCOC(=NC(=O)N(C)C)NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H22N4O3/c1-7-18-9(13-10(17)15(5)6)12-8(16)14-11(2,3)4/h7H2,1-6H3,(H2,12,13,14,16,17) |
| InChIKey | PQKXUXAFUNJHBY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|