About prop-2-enyl N'-[di(propan-2-yl)carbamoyl]carbamimidate
prop-2-enyl N'-[di(propan-2-yl)carbamoyl]carbamimidate (PubChem CID 21442393) has the molecular formula C11H21N3O2
and a molecular weight of 227.31 g/mol. Its IUPAC name is prop-2-enyl N'-[di(propan-2-yl)carbamoyl]carbamimidate.
Molecular Properties
| Compound Name | prop-2-enyl N'-[di(propan-2-yl)carbamoyl]carbamimidate |
| PubChem CID | 21442393 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | prop-2-enyl N'-[di(propan-2-yl)carbamoyl]carbamimidate |
| SMILES | C=CCO/C(N)=N\C(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C11H21N3O2/c1-6-7-16-10(12)13-11(15)14(8(2)3)9(4)5/h6,8-9H,1,7H2,2-5H3,(H2,12,13,15) |
| InChIKey | VMYZKMBOKOYXHO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl N'-[di(propan-2-yl)carbamoyl]carbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl N'-[di(propan-2-yl)carbamoyl]carbamimidate?
The IUPAC name of prop-2-enyl N'-[di(propan-2-yl)carbamoyl]carbamimidate (CID 21442393) is prop-2-enyl N'-[di(propan-2-yl)carbamoyl]carbamimidate.
What is the SMILES notation for prop-2-enyl N'-[di(propan-2-yl)carbamoyl]carbamimidate?
The canonical SMILES for prop-2-enyl N'-[di(propan-2-yl)carbamoyl]carbamimidate is C=CCO/C(N)=N\C(=O)N(C(C)C)C(C)C.
What is the InChIKey of prop-2-enyl N'-[di(propan-2-yl)carbamoyl]carbamimidate?
The InChIKey is VMYZKMBOKOYXHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O2/c1-6-7-16-10(12)13-11(15)14(8(2)3)9(4)5/h6,8-9H,1,7H2,2-5H3,(H2,12,13,15).
What are the key properties of prop-2-enyl N'-[di(propan-2-yl)carbamoyl]carbamimidate?
prop-2-enyl N'-[di(propan-2-yl)carbamoyl]carbamimidate has a molecular weight of 227.31 g/mol, XLogP of 1.74, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl N'-[di(propan-2-yl)carbamoyl]carbamimidate is sourced from PubChem (CID 21442393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).