C8H15N3O2 — CID 154984724
prop-2-enyl N-(N'-propan-2-ylcarbamimidoyl)carbamate (PubChem CID 154984724) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is prop-2-enyl N-(N'-propan-2-ylcarbamimidoyl)carbamate.
| Compound Name | prop-2-enyl N-(N'-propan-2-ylcarbamimidoyl)carbamate |
|---|---|
| PubChem CID | 154984724 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | prop-2-enyl N-(N'-propan-2-ylcarbamimidoyl)carbamate |
| SMILES | C=CCOC(=O)N/C(N)=N/C(C)C |
| InChI | InChI=1S/C8H15N3O2/c1-4-5-13-8(12)11-7(9)10-6(2)3/h4,6H,1,5H2,2-3H3,(H3,9,10,11,12) |
| InChIKey | RXENNJZCZAMXMM-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|