About prop-2-enyl 5-butylsulfanyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate
prop-2-enyl 5-butylsulfanyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate (PubChem CID 54192353) has the molecular formula C13H20N4O3S2
and a molecular weight of 344.46 g/mol. Its IUPAC name is prop-2-enyl 5-butylsulfanyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate.
Molecular Properties
| Compound Name | prop-2-enyl 5-butylsulfanyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate |
| PubChem CID | 54192353 |
| Molecular Formula | C13H20N4O3S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | prop-2-enyl 5-butylsulfanyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate |
| SMILES | C=CCOC(=O)n1nc(SCCCC)sc1=NC(=O)N(C)C |
| InChI | InChI=1S/C13H20N4O3S2/c1-5-7-9-21-12-15-17(13(19)20-8-6-2)11(22-12)14-10(18)16(3)4/h6H,2,5,7-9H2,1,3-4H3 |
| InChIKey | PJKFBNHWQKHLJN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 76.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 5-butylsulfanyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 5-butylsulfanyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate?
The IUPAC name of prop-2-enyl 5-butylsulfanyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate (CID 54192353) is prop-2-enyl 5-butylsulfanyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate.
What is the SMILES notation for prop-2-enyl 5-butylsulfanyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate?
The canonical SMILES for prop-2-enyl 5-butylsulfanyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate is C=CCOC(=O)n1nc(SCCCC)sc1=NC(=O)N(C)C.
What is the InChIKey of prop-2-enyl 5-butylsulfanyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate?
The InChIKey is PJKFBNHWQKHLJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O3S2/c1-5-7-9-21-12-15-17(13(19)20-8-6-2)11(22-12)14-10(18)16(3)4/h6H,2,5,7-9H2,1,3-4H3.
What are the key properties of prop-2-enyl 5-butylsulfanyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate?
prop-2-enyl 5-butylsulfanyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate has a molecular weight of 344.46 g/mol, XLogP of 2.59, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 5-butylsulfanyl-2-(dimethylcarbamoylimino)-1,3,4-thiadiazole-3-carboxylate is sourced from PubChem (CID 54192353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).