C14H22N4O3S2 — CID 54330955
butyl 2-(dimethylcarbamoylimino)-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazole-3-carboxylate (PubChem CID 54330955) has the molecular formula C14H22N4O3S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is butyl 2-(dimethylcarbamoylimino)-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazole-3-carboxylate.
| Compound Name | butyl 2-(dimethylcarbamoylimino)-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazole-3-carboxylate |
|---|---|
| PubChem CID | 54330955 |
| Molecular Formula | C14H22N4O3S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | butyl 2-(dimethylcarbamoylimino)-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazole-3-carboxylate |
| SMILES | C=C(C)CSc1nn(C(=O)OCCCC)c(=NC(=O)N(C)C)s1 |
| InChI | InChI=1S/C14H22N4O3S2/c1-6-7-8-21-14(20)18-12(15-11(19)17(4)5)23-13(16-18)22-9-10(2)3/h2,6-9H2,1,3-5H3 |
| InChIKey | SYHNGBXGISEMEC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 76.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|