C16H27BN2O4 — CID 175891490
butyl 3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate (PubChem CID 175891490) has the molecular formula C16H27BN2O4 and a molecular weight of 322.21 g/mol. Its IUPAC name is butyl 3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate.
| Compound Name | butyl 3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 175891490 |
| Molecular Formula | C16H27BN2O4 |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | butyl 3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate |
| SMILES | CCCCOC(=O)n1nc(C)c(B2OC(C)(C)C(C)(C)O2)c1C |
| InChI | InChI=1S/C16H27BN2O4/c1-8-9-10-21-14(20)19-12(3)13(11(2)18-19)17-22-15(4,5)16(6,7)23-17/h8-10H2,1-7H3 |
| InChIKey | KZZOTCYDIJPTMZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|