C21H29BF3NO4 — CID 163281950
butyl 6-(difluoromethyl)-5-fluoro-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 163281950) has the molecular formula C21H29BF3NO4 and a molecular weight of 427.27 g/mol. Its IUPAC name is butyl 6-(difluoromethyl)-5-fluoro-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | butyl 6-(difluoromethyl)-5-fluoro-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 163281950 |
| Molecular Formula | C21H29BF3NO4 |
| Molecular Weight | 427.27 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | butyl 6-(difluoromethyl)-5-fluoro-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CCCCOC(=O)N1CCc2c(F)c(C(F)F)cc(B3OC(C)(C)C(C)(C)O3)c2C1 |
| InChI | InChI=1S/C21H29BF3NO4/c1-6-7-10-28-19(27)26-9-8-13-15(12-26)16(11-14(17(13)23)18(24)25)22-29-20(2,3)21(4,5)30-22/h11,18H,6-10,12H2,1-5H3 |
| InChIKey | CPYMNKHEDIBZGK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.27 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|