C24H35BN2O6 — CID 141304783
butyl 4-[2-cyano-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]piperidine-1-carboxylate (PubChem CID 141304783) has the molecular formula C24H35BN2O6 and a molecular weight of 458.36 g/mol. Its IUPAC name is butyl 4-[2-cyano-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]piperidine-1-carboxylate.
| Compound Name | butyl 4-[2-cyano-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 141304783 |
| Molecular Formula | C24H35BN2O6 |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | butyl 4-[2-cyano-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(Oc2c(C#N)cc(B3OC(C)(C)C(C)(C)O3)cc2OC)CC1 |
| InChI | InChI=1S/C24H35BN2O6/c1-7-8-13-30-22(28)27-11-9-19(10-12-27)31-21-17(16-26)14-18(15-20(21)29-6)25-32-23(2,3)24(4,5)33-25/h14-15,19H,7-13H2,1-6H3 |
| InChIKey | QIZMEHRECUYAOD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 90.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|