C29H36BN3O5 — CID 172780195
butyl N-[(3S)-1-[3-(4-cyanophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]pyrrolidin-3-yl]carbamate (PubChem CID 172780195) has the molecular formula C29H36BN3O5 and a molecular weight of 517.44 g/mol. Its IUPAC name is butyl N-[(3S)-1-[3-(4-cyanophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | butyl N-[(3S)-1-[3-(4-cyanophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 172780195 |
| Molecular Formula | C29H36BN3O5 |
| Molecular Weight | 517.44 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | butyl N-[(3S)-1-[3-(4-cyanophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCCCOC(=O)N[C@H]1CCN(C(=O)c2ccc(B3OC(C)(C)C(C)(C)O3)c(-c3ccc(C#N)cc3)c2)C1 |
| InChI | InChI=1S/C29H36BN3O5/c1-6-7-16-36-27(35)32-23-14-15-33(19-23)26(34)22-12-13-25(30-37-28(2,3)29(4,5)38-30)24(17-22)21-10-8-20(18-31)9-11-21/h8-13,17,23H,6-7,14-16,19H2,1-5H3,(H,32,35)/t23-/m0/s1 |
| InChIKey | ODQSMHSJCYTUNO-QHCPKHFHSA-N |
| XLogP | 4.27 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|