C19H27BClN3O4 — CID 175807345
butyl 3-amino-5-chloro-6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate (PubChem CID 175807345) has the molecular formula C19H27BClN3O4 and a molecular weight of 407.71 g/mol. Its IUPAC name is butyl 3-amino-5-chloro-6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate.
| Compound Name | butyl 3-amino-5-chloro-6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate |
|---|---|
| PubChem CID | 175807345 |
| Molecular Formula | C19H27BClN3O4 |
| Molecular Weight | 407.71 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | butyl 3-amino-5-chloro-6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate |
| SMILES | CCCCOC(=O)n1nc(N)c2c(B3OC(C)(C)C(C)(C)O3)c(Cl)c(C)cc21 |
| InChI | InChI=1S/C19H27BClN3O4/c1-7-8-9-26-17(25)24-12-10-11(2)15(21)14(13(12)16(22)23-24)20-27-18(3,4)19(5,6)28-20/h10H,7-9H2,1-6H3,(H2,22,23) |
| InChIKey | DDHKLUROJSMACC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.71 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|