C19H30N2O2S — CID 21445571
4-[2-[di(propan-2-yl)amino]ethyl]-6,7-dimethoxy-3,4-dihydro-2H-isoquinoline-1-thione (PubChem CID 21445571) has the molecular formula C19H30N2O2S and a molecular weight of 350.53 g/mol. Its IUPAC name is 4-[2-[di(propan-2-yl)amino]ethyl]-6,7-dimethoxy-3,4-dihydro-2H-isoquinoline-1-thione.
| Compound Name | 4-[2-[di(propan-2-yl)amino]ethyl]-6,7-dimethoxy-3,4-dihydro-2H-isoquinoline-1-thione |
|---|---|
| PubChem CID | 21445571 |
| Molecular Formula | C19H30N2O2S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 4-[2-[di(propan-2-yl)amino]ethyl]-6,7-dimethoxy-3,4-dihydro-2H-isoquinoline-1-thione |
| SMILES | COc1cc2c(cc1OC)C(CCN(C(C)C)C(C)C)CNC2=S |
| InChI | InChI=1S/C19H30N2O2S/c1-12(2)21(13(3)4)8-7-14-11-20-19(24)16-10-18(23-6)17(22-5)9-15(14)16/h9-10,12-14H,7-8,11H2,1-6H3,(H,20,24) |
| InChIKey | JRNVWFMRVATGCA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|