C17H26N2O4 — CID 21450221
4-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-N-methyl-4-oxobutanamide (PubChem CID 21450221) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-N-methyl-4-oxobutanamide.
| Compound Name | 4-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-N-methyl-4-oxobutanamide |
|---|---|
| PubChem CID | 21450221 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 4-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-N-methyl-4-oxobutanamide |
| SMILES | CNC(=O)CCC(=O)c1ccc(OCC(O)CNC(C)C)cc1 |
| InChI | InChI=1S/C17H26N2O4/c1-12(2)19-10-14(20)11-23-15-6-4-13(5-7-15)16(21)8-9-17(22)18-3/h4-7,12,14,19-20H,8-11H2,1-3H3,(H,18,22) |
| InChIKey | GIYHIXRKARCHKY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |