C24H35N3O2 — CID 21451501
(3,4-diaminophenyl)-[4-[1-(dibutylamino)propan-2-yloxy]phenyl]methanone (PubChem CID 21451501) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is (3,4-diaminophenyl)-[4-[1-(dibutylamino)propan-2-yloxy]phenyl]methanone.
| Compound Name | (3,4-diaminophenyl)-[4-[1-(dibutylamino)propan-2-yloxy]phenyl]methanone |
|---|---|
| PubChem CID | 21451501 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | (3,4-diaminophenyl)-[4-[1-(dibutylamino)propan-2-yloxy]phenyl]methanone |
| SMILES | CCCCN(CCCC)CC(C)Oc1ccc(C(=O)c2ccc(N)c(N)c2)cc1 |
| InChI | InChI=1S/C24H35N3O2/c1-4-6-14-27(15-7-5-2)17-18(3)29-21-11-8-19(9-12-21)24(28)20-10-13-22(25)23(26)16-20/h8-13,16,18H,4-7,14-15,17,25-26H2,1-3H3 |
| InChIKey | SPGKVMYFFVXTIQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|