C25H37N3O2 — CID 21451658
(3,4-diaminophenyl)-[2-[3-(dibutylamino)butan-2-yloxy]phenyl]methanone (PubChem CID 21451658) has the molecular formula C25H37N3O2 and a molecular weight of 411.59 g/mol. Its IUPAC name is (3,4-diaminophenyl)-[2-[3-(dibutylamino)butan-2-yloxy]phenyl]methanone.
| Compound Name | (3,4-diaminophenyl)-[2-[3-(dibutylamino)butan-2-yloxy]phenyl]methanone |
|---|---|
| PubChem CID | 21451658 |
| Molecular Formula | C25H37N3O2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | (3,4-diaminophenyl)-[2-[3-(dibutylamino)butan-2-yloxy]phenyl]methanone |
| SMILES | CCCCN(CCCC)C(C)C(C)Oc1ccccc1C(=O)c1ccc(N)c(N)c1 |
| InChI | InChI=1S/C25H37N3O2/c1-5-7-15-28(16-8-6-2)18(3)19(4)30-24-12-10-9-11-21(24)25(29)20-13-14-22(26)23(27)17-20/h9-14,17-19H,5-8,15-16,26-27H2,1-4H3 |
| InChIKey | DHSLNNRFGYNMTC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|