C8H13N5O5 — CID 21453553
propane-1,1,1,2,2-pentacarboxamide (PubChem CID 21453553) has the molecular formula C8H13N5O5 and a molecular weight of 259.22 g/mol. Its IUPAC name is propane-1,1,1,2,2-pentacarboxamide.
| Compound Name | propane-1,1,1,2,2-pentacarboxamide |
|---|---|
| PubChem CID | 21453553 |
| Molecular Formula | C8H13N5O5 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | propane-1,1,1,2,2-pentacarboxamide |
| SMILES | CC(C(N)=O)(C(N)=O)C(C(N)=O)(C(N)=O)C(N)=O |
| InChI | InChI=1S/C8H13N5O5/c1-7(2(9)14,3(10)15)8(4(11)16,5(12)17)6(13)18/h1H3,(H2,9,14)(H2,10,15)(H2,11,16)(H2,12,17)(H2,13,18) |
| InChIKey | XWGXVIYUCSJDCL-UHFFFAOYSA-N |
| XLogP | -4.59 |
| TPSA | 215.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | -4.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|