C22H28N2O5 — CID 21454215
2-hydroxy-N-(2-methoxy-4-nitrophenyl)-5-(2,4,4-trimethylpentan-2-yl)benzamide (PubChem CID 21454215) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-hydroxy-N-(2-methoxy-4-nitrophenyl)-5-(2,4,4-trimethylpentan-2-yl)benzamide.
| Compound Name | 2-hydroxy-N-(2-methoxy-4-nitrophenyl)-5-(2,4,4-trimethylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 21454215 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 2-hydroxy-N-(2-methoxy-4-nitrophenyl)-5-(2,4,4-trimethylpentan-2-yl)benzamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)c1cc(C(C)(C)CC(C)(C)C)ccc1O |
| InChI | InChI=1S/C22H28N2O5/c1-21(2,3)13-22(4,5)14-7-10-18(25)16(11-14)20(26)23-17-9-8-15(24(27)28)12-19(17)29-6/h7-12,25H,13H2,1-6H3,(H,23,26) |
| InChIKey | XWGCQWJRKGKSLA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|