C38H35N5 — CID 21454808
1,3-diethyl-2-[(E)-2-(1-methyl-2-phenylindol-3-yl)ethenyl]-5,6-diphenyl-2H-imidazo[4,5-b]pyrazine (PubChem CID 21454808) has the molecular formula C38H35N5 and a molecular weight of 561.73 g/mol. Its IUPAC name is 1,3-diethyl-2-[(E)-2-(1-methyl-2-phenylindol-3-yl)ethenyl]-5,6-diphenyl-2H-imidazo[4,5-b]pyrazine.
| Compound Name | 1,3-diethyl-2-[(E)-2-(1-methyl-2-phenylindol-3-yl)ethenyl]-5,6-diphenyl-2H-imidazo[4,5-b]pyrazine |
|---|---|
| PubChem CID | 21454808 |
| Molecular Formula | C38H35N5 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | 1,3-diethyl-2-[(E)-2-(1-methyl-2-phenylindol-3-yl)ethenyl]-5,6-diphenyl-2H-imidazo[4,5-b]pyrazine |
| SMILES | CCN1c2nc(-c3ccccc3)c(-c3ccccc3)nc2N(CC)C1/C=C/c1c(-c2ccccc2)n(C)c2ccccc12 |
| InChI | InChI=1S/C38H35N5/c1-4-42-33(26-25-31-30-23-15-16-24-32(30)41(3)36(31)29-21-13-8-14-22-29)43(5-2)38-37(42)39-34(27-17-9-6-10-18-27)35(40-38)28-19-11-7-12-20-28/h6-26,33H,4-5H2,1-3H3/b26-25+ |
| InChIKey | AKKHTRJTSACREH-OCEACIFDSA-N |
| XLogP | 8.68 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|