About [8,9-bis[(3-chlorobenzoyl)oxy]anthracen-1-yl] 3-chlorobenzoate
[8,9-bis[(3-chlorobenzoyl)oxy]anthracen-1-yl] 3-chlorobenzoate (PubChem CID 21455213) has the molecular formula C35H19Cl3O6
and a molecular weight of 641.89 g/mol. Its IUPAC name is [8,9-bis[(3-chlorobenzoyl)oxy]anthracen-1-yl] 3-chlorobenzoate.
Molecular Properties
| Compound Name | [8,9-bis[(3-chlorobenzoyl)oxy]anthracen-1-yl] 3-chlorobenzoate |
| PubChem CID | 21455213 |
| Molecular Formula | C35H19Cl3O6 |
| Molecular Weight | 641.89 g/mol |
| Exact Mass | 640.02 |
| IUPAC Name | [8,9-bis[(3-chlorobenzoyl)oxy]anthracen-1-yl] 3-chlorobenzoate |
| SMILES | O=C(Oc1cccc2cc3cccc(OC(=O)c4cccc(Cl)c4)c3c(OC(=O)c3cccc(Cl)c3)c12)c1cccc(Cl)c1 |
| InChI | InChI=1S/C35H19Cl3O6/c36-25-11-1-8-22(17-25)33(39)42-28-14-4-6-20-16-21-7-5-15-29(43-34(40)23-9-2-12-26(37)18-23)31(21)32(30(20)28)44-35(41)24-10-3-13-27(38)19-24/h1-19H |
| InChIKey | GZLOGJQBERKJQP-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 641.89 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze [8,9-bis[(3-chlorobenzoyl)oxy]anthracen-1-yl] 3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8,9-bis[(3-chlorobenzoyl)oxy]anthracen-1-yl] 3-chlorobenzoate?
The IUPAC name of [8,9-bis[(3-chlorobenzoyl)oxy]anthracen-1-yl] 3-chlorobenzoate (CID 21455213) is [8,9-bis[(3-chlorobenzoyl)oxy]anthracen-1-yl] 3-chlorobenzoate.
What is the SMILES notation for [8,9-bis[(3-chlorobenzoyl)oxy]anthracen-1-yl] 3-chlorobenzoate?
The canonical SMILES for [8,9-bis[(3-chlorobenzoyl)oxy]anthracen-1-yl] 3-chlorobenzoate is O=C(Oc1cccc2cc3cccc(OC(=O)c4cccc(Cl)c4)c3c(OC(=O)c3cccc(Cl)c3)c12)c1cccc(Cl)c1.
What is the InChIKey of [8,9-bis[(3-chlorobenzoyl)oxy]anthracen-1-yl] 3-chlorobenzoate?
The InChIKey is GZLOGJQBERKJQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H19Cl3O6/c36-25-11-1-8-22(17-25)33(39)42-28-14-4-6-20-16-21-7-5-15-29(43-34(40)23-9-2-12-26(37)18-23)31(21)32(30(20)28)44-35(41)24-10-3-13-27(38)19-24/h1-19H.
What are the key properties of [8,9-bis[(3-chlorobenzoyl)oxy]anthracen-1-yl] 3-chlorobenzoate?
[8,9-bis[(3-chlorobenzoyl)oxy]anthracen-1-yl] 3-chlorobenzoate has a molecular weight of 641.89 g/mol, XLogP of 9.61, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [8,9-bis[(3-chlorobenzoyl)oxy]anthracen-1-yl] 3-chlorobenzoate is sourced from PubChem (CID 21455213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).