C15H20O5 — CID 21459459
3-(3-methyl-6-oxo-1,4-dioxaspiro[4.5]decan-7-yl)cyclohexane-1,2-dione (PubChem CID 21459459) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is 3-(3-methyl-6-oxo-1,4-dioxaspiro[4.5]decan-7-yl)cyclohexane-1,2-dione.
| Compound Name | 3-(3-methyl-6-oxo-1,4-dioxaspiro[4.5]decan-7-yl)cyclohexane-1,2-dione |
|---|---|
| PubChem CID | 21459459 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 3-(3-methyl-6-oxo-1,4-dioxaspiro[4.5]decan-7-yl)cyclohexane-1,2-dione |
| SMILES | CC1COC2(CCCC(C3CCCC(=O)C3=O)C2=O)O1 |
| InChI | InChI=1S/C15H20O5/c1-9-8-19-15(20-9)7-3-5-11(14(15)18)10-4-2-6-12(16)13(10)17/h9-11H,2-8H2,1H3 |
| InChIKey | JFMKOVWRFXJPNU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|