C8H8N2 — CID 21462556
7H-pyrrolo[1,2-a][1,4]diazepine (PubChem CID 21462556) has the molecular formula C8H8N2 and a molecular weight of 132.17 g/mol. Its IUPAC name is 7H-pyrrolo[1,2-a][1,4]diazepine.
| Compound Name | 7H-pyrrolo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 21462556 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 7H-pyrrolo[1,2-a][1,4]diazepine |
| SMILES | C1=CN2CC=CC2=CN=C1 |
| InChI | InChI=1S/C8H8N2/c1-3-8-7-9-4-2-6-10(8)5-1/h1-4,6-7H,5H2 |
| InChIKey | NHZIBKHDTHZSGW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |