C9H12N2O3 — CID 21465815
N,N-dimethylprop-2-enamide;pyrrole-2,5-dione (PubChem CID 21465815) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is N,N-dimethylprop-2-enamide;pyrrole-2,5-dione.
| Compound Name | N,N-dimethylprop-2-enamide;pyrrole-2,5-dione |
|---|---|
| PubChem CID | 21465815 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | N,N-dimethylprop-2-enamide;pyrrole-2,5-dione |
| SMILES | C=CC(=O)N(C)C.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C5H9NO.C4H3NO2/c1-4-5(7)6(2)3;6-3-1-2-4(7)5-3/h4H,1H2,2-3H3;1-2H,(H,5,6,7) |
| InChIKey | IWXDXQKNXOGNEZ-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|