About (2-chlorophenyl) (4-propan-2-yloxyphenyl) carbonate
(2-chlorophenyl) (4-propan-2-yloxyphenyl) carbonate (PubChem CID 21467853) has the molecular formula C16H15ClO4
and a molecular weight of 306.75 g/mol. Its IUPAC name is (2-chlorophenyl) (4-propan-2-yloxyphenyl) carbonate.
Molecular Properties
| Compound Name | (2-chlorophenyl) (4-propan-2-yloxyphenyl) carbonate |
| PubChem CID | 21467853 |
| Molecular Formula | C16H15ClO4 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | (2-chlorophenyl) (4-propan-2-yloxyphenyl) carbonate |
| SMILES | CC(C)Oc1ccc(OC(=O)Oc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C16H15ClO4/c1-11(2)19-12-7-9-13(10-8-12)20-16(18)21-15-6-4-3-5-14(15)17/h3-11H,1-2H3 |
| InChIKey | BLNGFYBVVTVZLC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (2-chlorophenyl) (4-propan-2-yloxyphenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl) (4-propan-2-yloxyphenyl) carbonate?
The IUPAC name of (2-chlorophenyl) (4-propan-2-yloxyphenyl) carbonate (CID 21467853) is (2-chlorophenyl) (4-propan-2-yloxyphenyl) carbonate.
What is the SMILES notation for (2-chlorophenyl) (4-propan-2-yloxyphenyl) carbonate?
The canonical SMILES for (2-chlorophenyl) (4-propan-2-yloxyphenyl) carbonate is CC(C)Oc1ccc(OC(=O)Oc2ccccc2Cl)cc1.
What is the InChIKey of (2-chlorophenyl) (4-propan-2-yloxyphenyl) carbonate?
The InChIKey is BLNGFYBVVTVZLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClO4/c1-11(2)19-12-7-9-13(10-8-12)20-16(18)21-15-6-4-3-5-14(15)17/h3-11H,1-2H3.
What are the key properties of (2-chlorophenyl) (4-propan-2-yloxyphenyl) carbonate?
(2-chlorophenyl) (4-propan-2-yloxyphenyl) carbonate has a molecular weight of 306.75 g/mol, XLogP of 4.70, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl) (4-propan-2-yloxyphenyl) carbonate is sourced from PubChem (CID 21467853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).