About (2-chlorophenyl) (4-nonylphenyl) carbonate
(2-chlorophenyl) (4-nonylphenyl) carbonate (PubChem CID 22994736) has the molecular formula C22H27ClO3
and a molecular weight of 374.91 g/mol. Its IUPAC name is (2-chlorophenyl) (4-nonylphenyl) carbonate.
Molecular Properties
| Compound Name | (2-chlorophenyl) (4-nonylphenyl) carbonate |
| PubChem CID | 22994736 |
| Molecular Formula | C22H27ClO3 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | (2-chlorophenyl) (4-nonylphenyl) carbonate |
| SMILES | CCCCCCCCCc1ccc(OC(=O)Oc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C22H27ClO3/c1-2-3-4-5-6-7-8-11-18-14-16-19(17-15-18)25-22(24)26-21-13-10-9-12-20(21)23/h9-10,12-17H,2-8,11H2,1H3 |
| InChIKey | LWSXVZXWBXMGNZ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (2-chlorophenyl) (4-nonylphenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl) (4-nonylphenyl) carbonate?
The IUPAC name of (2-chlorophenyl) (4-nonylphenyl) carbonate (CID 22994736) is (2-chlorophenyl) (4-nonylphenyl) carbonate.
What is the SMILES notation for (2-chlorophenyl) (4-nonylphenyl) carbonate?
The canonical SMILES for (2-chlorophenyl) (4-nonylphenyl) carbonate is CCCCCCCCCc1ccc(OC(=O)Oc2ccccc2Cl)cc1.
What is the InChIKey of (2-chlorophenyl) (4-nonylphenyl) carbonate?
The InChIKey is LWSXVZXWBXMGNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27ClO3/c1-2-3-4-5-6-7-8-11-18-14-16-19(17-15-18)25-22(24)26-21-13-10-9-12-20(21)23/h9-10,12-17H,2-8,11H2,1H3.
What are the key properties of (2-chlorophenyl) (4-nonylphenyl) carbonate?
(2-chlorophenyl) (4-nonylphenyl) carbonate has a molecular weight of 374.91 g/mol, XLogP of 7.21, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl) (4-nonylphenyl) carbonate is sourced from PubChem (CID 22994736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).