C8H14N2O2 — CID 21468650
2-(cyclopropylmethyl)butanediamide (PubChem CID 21468650) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)butanediamide.
| Compound Name | 2-(cyclopropylmethyl)butanediamide |
|---|---|
| PubChem CID | 21468650 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-(cyclopropylmethyl)butanediamide |
| SMILES | NC(=O)CC(CC1CC1)C(N)=O |
| InChI | InChI=1S/C8H14N2O2/c9-7(11)4-6(8(10)12)3-5-1-2-5/h5-6H,1-4H2,(H2,9,11)(H2,10,12) |
| InChIKey | KGXQHPSVLZVNKT-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |