C18H27ClN2O6 — CID 21468792
4-[2-(2-chloro-4-methoxyphenyl)ethyl-propylamino]butanamide;oxalic acid (PubChem CID 21468792) has the molecular formula C18H27ClN2O6 and a molecular weight of 402.88 g/mol. Its IUPAC name is 4-[2-(2-chloro-4-methoxyphenyl)ethyl-propylamino]butanamide;oxalic acid.
| Compound Name | 4-[2-(2-chloro-4-methoxyphenyl)ethyl-propylamino]butanamide;oxalic acid |
|---|---|
| PubChem CID | 21468792 |
| Molecular Formula | C18H27ClN2O6 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 4-[2-(2-chloro-4-methoxyphenyl)ethyl-propylamino]butanamide;oxalic acid |
| SMILES | CCCN(CCCC(N)=O)CCc1ccc(OC)cc1Cl.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H25ClN2O2.C2H2O4/c1-3-9-19(10-4-5-16(18)20)11-8-13-6-7-14(21-2)12-15(13)17;3-1(4)2(5)6/h6-7,12H,3-5,8-11H2,1-2H3,(H2,18,20);(H,3,4)(H,5,6) |
| InChIKey | QNRTVYMFFKKFNP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|