C16H21NO — CID 21470445
2-[(5,6,7,8-tetrahydronaphthalen-2-ylamino)methyl]pent-4-yn-1-ol (PubChem CID 21470445) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-[(5,6,7,8-tetrahydronaphthalen-2-ylamino)methyl]pent-4-yn-1-ol.
| Compound Name | 2-[(5,6,7,8-tetrahydronaphthalen-2-ylamino)methyl]pent-4-yn-1-ol |
|---|---|
| PubChem CID | 21470445 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 2-[(5,6,7,8-tetrahydronaphthalen-2-ylamino)methyl]pent-4-yn-1-ol |
| SMILES | C#CCC(CO)CNc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C16H21NO/c1-2-5-13(12-18)11-17-16-9-8-14-6-3-4-7-15(14)10-16/h1,8-10,13,17-18H,3-7,11-12H2 |
| InChIKey | IHSPIGAXYZNHIQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|