C16H23NO3 — CID 21470540
4-[[[(2E,4E,6E)-octa-2,4,6-trienoyl]amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 21470540) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 4-[[[(2E,4E,6E)-octa-2,4,6-trienoyl]amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[[(2E,4E,6E)-octa-2,4,6-trienoyl]amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 21470540 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 4-[[[(2E,4E,6E)-octa-2,4,6-trienoyl]amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | C/C=C/C=C/C=C/C(=O)NCC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C16H23NO3/c1-2-3-4-5-6-7-15(18)17-12-13-8-10-14(11-9-13)16(19)20/h2-7,13-14H,8-12H2,1H3,(H,17,18)(H,19,20)/b3-2+,5-4+,7-6+ |
| InChIKey | KVUWNYKDTHQFBC-ICDJNDDTSA-N |
| XLogP | 2.68 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|