C10H12ClNO3 — CID 21474024
1-(2-amino-4-chlorophenyl)-2,2-dimethoxyethanone (PubChem CID 21474024) has the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. Its IUPAC name is 1-(2-amino-4-chlorophenyl)-2,2-dimethoxyethanone.
| Compound Name | 1-(2-amino-4-chlorophenyl)-2,2-dimethoxyethanone |
|---|---|
| PubChem CID | 21474024 |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 1-(2-amino-4-chlorophenyl)-2,2-dimethoxyethanone |
| SMILES | COC(OC)C(=O)c1ccc(Cl)cc1N |
| InChI | InChI=1S/C10H12ClNO3/c1-14-10(15-2)9(13)7-4-3-6(11)5-8(7)12/h3-5,10H,12H2,1-2H3 |
| InChIKey | GOTYBYHZHLNYST-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|