C24H32N2O4 — CID 21476358
2-[4,7,7-trimethyl-2-[4-(2-methylphenyl)piperazine-1-carbonyl]-3-oxo-2-bicyclo[2.2.1]heptanyl]acetic acid (PubChem CID 21476358) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-[4,7,7-trimethyl-2-[4-(2-methylphenyl)piperazine-1-carbonyl]-3-oxo-2-bicyclo[2.2.1]heptanyl]acetic acid.
| Compound Name | 2-[4,7,7-trimethyl-2-[4-(2-methylphenyl)piperazine-1-carbonyl]-3-oxo-2-bicyclo[2.2.1]heptanyl]acetic acid |
|---|---|
| PubChem CID | 21476358 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 2-[4,7,7-trimethyl-2-[4-(2-methylphenyl)piperazine-1-carbonyl]-3-oxo-2-bicyclo[2.2.1]heptanyl]acetic acid |
| SMILES | Cc1ccccc1N1CCN(C(=O)C2(CC(=O)O)C(=O)C3(C)CCC2C3(C)C)CC1 |
| InChI | InChI=1S/C24H32N2O4/c1-16-7-5-6-8-17(16)25-11-13-26(14-12-25)21(30)24(15-19(27)28)18-9-10-23(4,20(24)29)22(18,2)3/h5-8,18H,9-15H2,1-4H3,(H,27,28) |
| InChIKey | UWRXDWAXGLCOGR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|