C16H17N2O4- — CID 21479706
4-(4-methoxyphenyl)-3-morpholin-4-yl-1H-pyrrole-2-carboxylate (PubChem CID 21479706) has the molecular formula C16H17N2O4- and a molecular weight of 301.32 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3-morpholin-4-yl-1H-pyrrole-2-carboxylate.
| Compound Name | 4-(4-methoxyphenyl)-3-morpholin-4-yl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 21479706 |
| Molecular Formula | C16H17N2O4- |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 4-(4-methoxyphenyl)-3-morpholin-4-yl-1H-pyrrole-2-carboxylate |
| SMILES | COc1ccc(-c2c[nH]c(C(=O)[O-])c2N2CCOCC2)cc1 |
| InChI | InChI=1S/C16H18N2O4/c1-21-12-4-2-11(3-5-12)13-10-17-14(16(19)20)15(13)18-6-8-22-9-7-18/h2-5,10,17H,6-9H2,1H3,(H,19,20)/p-1 |
| InChIKey | ZNJIYECBOJYBJD-UHFFFAOYSA-M |
| XLogP | 0.89 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |