C10H14N4O2 — CID 21481192
1-(cyclohexanecarbonyl)-1,2,4-triazole-3-carboxamide (PubChem CID 21481192) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 1-(cyclohexanecarbonyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-(cyclohexanecarbonyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 21481192 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 1-(cyclohexanecarbonyl)-1,2,4-triazole-3-carboxamide |
| SMILES | NC(=O)c1ncn(C(=O)C2CCCCC2)n1 |
| InChI | InChI=1S/C10H14N4O2/c11-8(15)9-12-6-14(13-9)10(16)7-4-2-1-3-5-7/h6-7H,1-5H2,(H2,11,15) |
| InChIKey | WSKILMBEPZUZDS-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |