C14H22N2O3S — CID 2148226
N-cyclohexyl-2-[(2S,6S)-2,6-dimethyl-3,5-dioxothiomorpholin-4-yl]acetamide (PubChem CID 2148226) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is N-cyclohexyl-2-[(2S,6S)-2,6-dimethyl-3,5-dioxothiomorpholin-4-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[(2S,6S)-2,6-dimethyl-3,5-dioxothiomorpholin-4-yl]acetamide |
|---|---|
| PubChem CID | 2148226 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-cyclohexyl-2-[(2S,6S)-2,6-dimethyl-3,5-dioxothiomorpholin-4-yl]acetamide |
| SMILES | C[C@@H]1S[C@@H](C)C(=O)N(CC(=O)NC2CCCCC2)C1=O |
| InChI | InChI=1S/C14H22N2O3S/c1-9-13(18)16(14(19)10(2)20-9)8-12(17)15-11-6-4-3-5-7-11/h9-11H,3-8H2,1-2H3,(H,15,17)/t9-,10-/m0/s1 |
| InChIKey | ZUPVPFCXPPWOCS-UWVGGRQHSA-N |
| XLogP | 1.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|