C17H22Br2N2O3 — CID 3534274
N-cyclohexyl-2-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)acetamide (PubChem CID 3534274) has the molecular formula C17H22Br2N2O3 and a molecular weight of 462.18 g/mol. Its IUPAC name is N-cyclohexyl-2-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)acetamide.
| Compound Name | N-cyclohexyl-2-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)acetamide |
|---|---|
| PubChem CID | 3534274 |
| Molecular Formula | C17H22Br2N2O3 |
| Molecular Weight | 462.18 g/mol |
| Exact Mass | 460.00 |
| IUPAC Name | N-cyclohexyl-2-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)acetamide |
| SMILES | O=C(CN1C(=O)C2C3CC(C(Br)C3Br)C2C1=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H22Br2N2O3/c18-14-9-6-10(15(14)19)13-12(9)16(23)21(17(13)24)7-11(22)20-8-4-2-1-3-5-8/h8-10,12-15H,1-7H2,(H,20,22) |
| InChIKey | PZHVKRRUBQELHG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.18 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|