About 2-methoxy-2-(1,3-thiazol-2-yl)ethanethioamide
2-methoxy-2-(1,3-thiazol-2-yl)ethanethioamide (PubChem CID 21486875) has the molecular formula C6H8N2OS2
and a molecular weight of 188.28 g/mol. Its IUPAC name is 2-methoxy-2-(1,3-thiazol-2-yl)ethanethioamide.
Molecular Properties
| Compound Name | 2-methoxy-2-(1,3-thiazol-2-yl)ethanethioamide |
| PubChem CID | 21486875 |
| Molecular Formula | C6H8N2OS2 |
| Molecular Weight | 188.28 g/mol |
| Exact Mass | 188.01 |
| IUPAC Name | 2-methoxy-2-(1,3-thiazol-2-yl)ethanethioamide |
| SMILES | COC(C(N)=S)c1nccs1 |
| InChI | InChI=1S/C6H8N2OS2/c1-9-4(5(7)10)6-8-2-3-11-6/h2-4H,1H3,(H2,7,10) |
| InChIKey | YOPFPGYWGHHXHE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-2-(1,3-thiazol-2-yl)ethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-2-(1,3-thiazol-2-yl)ethanethioamide?
The IUPAC name of 2-methoxy-2-(1,3-thiazol-2-yl)ethanethioamide (CID 21486875) is 2-methoxy-2-(1,3-thiazol-2-yl)ethanethioamide.
What is the SMILES notation for 2-methoxy-2-(1,3-thiazol-2-yl)ethanethioamide?
The canonical SMILES for 2-methoxy-2-(1,3-thiazol-2-yl)ethanethioamide is COC(C(N)=S)c1nccs1.
What is the InChIKey of 2-methoxy-2-(1,3-thiazol-2-yl)ethanethioamide?
The InChIKey is YOPFPGYWGHHXHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2OS2/c1-9-4(5(7)10)6-8-2-3-11-6/h2-4H,1H3,(H2,7,10).
What are the key properties of 2-methoxy-2-(1,3-thiazol-2-yl)ethanethioamide?
2-methoxy-2-(1,3-thiazol-2-yl)ethanethioamide has a molecular weight of 188.28 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-2-(1,3-thiazol-2-yl)ethanethioamide is sourced from PubChem (CID 21486875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).