C18H24F3NO2 — CID 21488081
[1-cyclopropyl-3-(dimethylamino)-1-[3-(trifluoromethyl)phenyl]propyl] propanoate (PubChem CID 21488081) has the molecular formula C18H24F3NO2 and a molecular weight of 343.39 g/mol. Its IUPAC name is [1-cyclopropyl-3-(dimethylamino)-1-[3-(trifluoromethyl)phenyl]propyl] propanoate.
| Compound Name | [1-cyclopropyl-3-(dimethylamino)-1-[3-(trifluoromethyl)phenyl]propyl] propanoate |
|---|---|
| PubChem CID | 21488081 |
| Molecular Formula | C18H24F3NO2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | [1-cyclopropyl-3-(dimethylamino)-1-[3-(trifluoromethyl)phenyl]propyl] propanoate |
| SMILES | CCC(=O)OC(CCN(C)C)(c1cccc(C(F)(F)F)c1)C1CC1 |
| InChI | InChI=1S/C18H24F3NO2/c1-4-16(23)24-17(13-8-9-13,10-11-22(2)3)14-6-5-7-15(12-14)18(19,20)21/h5-7,12-13H,4,8-11H2,1-3H3 |
| InChIKey | WWYAVIVVWTZQBV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |