C19H42N2S — CID 21488148
1-N-[3-(11-methyldodecylsulfanyl)propyl]propane-1,2-diamine (PubChem CID 21488148) has the molecular formula C19H42N2S and a molecular weight of 330.63 g/mol. Its IUPAC name is 1-N-[3-(11-methyldodecylsulfanyl)propyl]propane-1,2-diamine.
| Compound Name | 1-N-[3-(11-methyldodecylsulfanyl)propyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 21488148 |
| Molecular Formula | C19H42N2S |
| Molecular Weight | 330.63 g/mol |
| Exact Mass | 330.31 |
| IUPAC Name | 1-N-[3-(11-methyldodecylsulfanyl)propyl]propane-1,2-diamine |
| SMILES | CC(C)CCCCCCCCCCSCCCNCC(C)N |
| InChI | InChI=1S/C19H42N2S/c1-18(2)13-10-8-6-4-5-7-9-11-15-22-16-12-14-21-17-19(3)20/h18-19,21H,4-17,20H2,1-3H3 |
| InChIKey | HIUQSQYZZIDPRZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|