About (2-ethyl-4-nitrophenyl) cyanate
(2-ethyl-4-nitrophenyl) cyanate (PubChem CID 21494859) has the molecular formula C9H8N2O3
and a molecular weight of 192.17 g/mol. Its IUPAC name is (2-ethyl-4-nitrophenyl) cyanate.
Molecular Properties
| Compound Name | (2-ethyl-4-nitrophenyl) cyanate |
| PubChem CID | 21494859 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | (2-ethyl-4-nitrophenyl) cyanate |
| SMILES | CCc1cc([N+](=O)[O-])ccc1OC#N |
| InChI | InChI=1S/C9H8N2O3/c1-2-7-5-8(11(12)13)3-4-9(7)14-6-10/h3-5H,2H2,1H3 |
| InChIKey | ULYBHRQVCDELMO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-ethyl-4-nitrophenyl) cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-4-nitrophenyl) cyanate?
The IUPAC name of (2-ethyl-4-nitrophenyl) cyanate (CID 21494859) is (2-ethyl-4-nitrophenyl) cyanate.
What is the SMILES notation for (2-ethyl-4-nitrophenyl) cyanate?
The canonical SMILES for (2-ethyl-4-nitrophenyl) cyanate is CCc1cc([N+](=O)[O-])ccc1OC#N.
What is the InChIKey of (2-ethyl-4-nitrophenyl) cyanate?
The InChIKey is ULYBHRQVCDELMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3/c1-2-7-5-8(11(12)13)3-4-9(7)14-6-10/h3-5H,2H2,1H3.
What are the key properties of (2-ethyl-4-nitrophenyl) cyanate?
(2-ethyl-4-nitrophenyl) cyanate has a molecular weight of 192.17 g/mol, XLogP of 2.02, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-4-nitrophenyl) cyanate is sourced from PubChem (CID 21494859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).