About (3,5-dinitrophenyl) cyanate
(3,5-dinitrophenyl) cyanate (PubChem CID 143526449) has the molecular formula C7H3N3O5
and a molecular weight of 209.12 g/mol. Its IUPAC name is (3,5-dinitrophenyl) cyanate.
Molecular Properties
| Compound Name | (3,5-dinitrophenyl) cyanate |
| PubChem CID | 143526449 |
| Molecular Formula | C7H3N3O5 |
| Molecular Weight | 209.12 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | (3,5-dinitrophenyl) cyanate |
| SMILES | N#COc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H3N3O5/c8-4-15-7-2-5(9(11)12)1-6(3-7)10(13)14/h1-3H |
| InChIKey | XMEXOGWQHYGESP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 119.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.12 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dinitrophenyl) cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dinitrophenyl) cyanate?
The IUPAC name of (3,5-dinitrophenyl) cyanate (CID 143526449) is (3,5-dinitrophenyl) cyanate.
What is the SMILES notation for (3,5-dinitrophenyl) cyanate?
The canonical SMILES for (3,5-dinitrophenyl) cyanate is N#COc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.
What is the InChIKey of (3,5-dinitrophenyl) cyanate?
The InChIKey is XMEXOGWQHYGESP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3N3O5/c8-4-15-7-2-5(9(11)12)1-6(3-7)10(13)14/h1-3H.
What are the key properties of (3,5-dinitrophenyl) cyanate?
(3,5-dinitrophenyl) cyanate has a molecular weight of 209.12 g/mol, XLogP of 1.36, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dinitrophenyl) cyanate is sourced from PubChem (CID 143526449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).