About [3-(cyanocarbamoyloxy)-5-nitrophenyl] N-cyanocarbamate
[3-(cyanocarbamoyloxy)-5-nitrophenyl] N-cyanocarbamate (PubChem CID 22076532) has the molecular formula C10H5N5O6
and a molecular weight of 291.18 g/mol. Its IUPAC name is [3-(cyanocarbamoyloxy)-5-nitrophenyl] N-cyanocarbamate.
Molecular Properties
| Compound Name | [3-(cyanocarbamoyloxy)-5-nitrophenyl] N-cyanocarbamate |
| PubChem CID | 22076532 |
| Molecular Formula | C10H5N5O6 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | [3-(cyanocarbamoyloxy)-5-nitrophenyl] N-cyanocarbamate |
| SMILES | N#CNC(=O)Oc1cc(OC(=O)NC#N)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H5N5O6/c11-4-13-9(16)20-7-1-6(15(18)19)2-8(3-7)21-10(17)14-5-12/h1-3H,(H,13,16)(H,14,17) |
| InChIKey | CLKYQPHZWUQEEY-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 167.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(cyanocarbamoyloxy)-5-nitrophenyl] N-cyanocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(cyanocarbamoyloxy)-5-nitrophenyl] N-cyanocarbamate?
The IUPAC name of [3-(cyanocarbamoyloxy)-5-nitrophenyl] N-cyanocarbamate (CID 22076532) is [3-(cyanocarbamoyloxy)-5-nitrophenyl] N-cyanocarbamate.
What is the SMILES notation for [3-(cyanocarbamoyloxy)-5-nitrophenyl] N-cyanocarbamate?
The canonical SMILES for [3-(cyanocarbamoyloxy)-5-nitrophenyl] N-cyanocarbamate is N#CNC(=O)Oc1cc(OC(=O)NC#N)cc([N+](=O)[O-])c1.
What is the InChIKey of [3-(cyanocarbamoyloxy)-5-nitrophenyl] N-cyanocarbamate?
The InChIKey is CLKYQPHZWUQEEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5N5O6/c11-4-13-9(16)20-7-1-6(15(18)19)2-8(3-7)21-10(17)14-5-12/h1-3H,(H,13,16)(H,14,17).
What are the key properties of [3-(cyanocarbamoyloxy)-5-nitrophenyl] N-cyanocarbamate?
[3-(cyanocarbamoyloxy)-5-nitrophenyl] N-cyanocarbamate has a molecular weight of 291.18 g/mol, XLogP of 0.73, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(cyanocarbamoyloxy)-5-nitrophenyl] N-cyanocarbamate is sourced from PubChem (CID 22076532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).