C26H22ClNO4S — CID 2150597
[6-chloro-4-(4-ethylphenyl)sulfonylquinolin-3-yl]-(4-ethoxyphenyl)methanone (PubChem CID 2150597) has the molecular formula C26H22ClNO4S and a molecular weight of 479.99 g/mol. Its IUPAC name is [6-chloro-4-(4-ethylphenyl)sulfonylquinolin-3-yl]-(4-ethoxyphenyl)methanone.
| Compound Name | [6-chloro-4-(4-ethylphenyl)sulfonylquinolin-3-yl]-(4-ethoxyphenyl)methanone |
|---|---|
| PubChem CID | 2150597 |
| Molecular Formula | C26H22ClNO4S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | [6-chloro-4-(4-ethylphenyl)sulfonylquinolin-3-yl]-(4-ethoxyphenyl)methanone |
| SMILES | CCOc1ccc(C(=O)c2cnc3ccc(Cl)cc3c2S(=O)(=O)c2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C26H22ClNO4S/c1-3-17-5-12-21(13-6-17)33(30,31)26-22-15-19(27)9-14-24(22)28-16-23(26)25(29)18-7-10-20(11-8-18)32-4-2/h5-16H,3-4H2,1-2H3 |
| InChIKey | BULINAMWMQOOAD-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |