About (4-Bromophenyl)(phenyl)methanamine hydrochloride
(4-Bromophenyl)(phenyl)methanamine hydrochloride (PubChem CID 21528791) has the molecular formula C13H13BrClN
and a molecular weight of 298.60 g/mol. Its IUPAC name is (4-bromophenyl)-phenylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | (4-Bromophenyl)(phenyl)methanamine hydrochloride |
| PubChem CID | 21528791 |
| Molecular Formula | C13H13BrClN |
| Molecular Weight | 298.60 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | (4-bromophenyl)-phenylmethanamine;hydrochloride |
| SMILES | C1=CC=C(C=C1)C(C2=CC=C(C=C2)Br)N.Cl |
| InChI | InChI=1S/C13H12BrN.ClH/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10;/h1-9,13H,15H2;1H |
| InChIKey | SZWHELGYDLPWLM-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | 181 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4-Bromophenyl)(phenyl)methanamine hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-Bromophenyl)(phenyl)methanamine hydrochloride?
The IUPAC name of (4-Bromophenyl)(phenyl)methanamine hydrochloride (CID 21528791) is (4-bromophenyl)-phenylmethanamine;hydrochloride.
What is the SMILES notation for (4-Bromophenyl)(phenyl)methanamine hydrochloride?
The canonical SMILES for (4-Bromophenyl)(phenyl)methanamine hydrochloride is C1=CC=C(C=C1)C(C2=CC=C(C=C2)Br)N.Cl.
What is the InChIKey of (4-Bromophenyl)(phenyl)methanamine hydrochloride?
The InChIKey is SZWHELGYDLPWLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrN.ClH/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10;/h1-9,13H,15H2;1H.
What are the key properties of (4-Bromophenyl)(phenyl)methanamine hydrochloride?
(4-Bromophenyl)(phenyl)methanamine hydrochloride has a molecular weight of 298.60 g/mol, XLogP of not available, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-Bromophenyl)(phenyl)methanamine hydrochloride is sourced from PubChem (CID 21528791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).