About [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 2,3-dimethoxybenzoate
[4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 2,3-dimethoxybenzoate (PubChem CID 2153742) has the molecular formula C25H21ClN2O4S
and a molecular weight of 480.97 g/mol. Its IUPAC name is [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 2,3-dimethoxybenzoate.
Molecular Properties
| Compound Name | [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 2,3-dimethoxybenzoate |
| PubChem CID | 2153742 |
| Molecular Formula | C25H21ClN2O4S |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 2,3-dimethoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2c(Sc3ccc(Cl)cc3)c(C)nn2-c2ccccc2)c1OC |
| InChI | InChI=1S/C25H21ClN2O4S/c1-16-23(33-19-14-12-17(26)13-15-19)24(28(27-16)18-8-5-4-6-9-18)32-25(29)20-10-7-11-21(30-2)22(20)31-3/h4-15H,1-3H3 |
| InChIKey | WZASQJNBXHMCCJ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 2,3-dimethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 2,3-dimethoxybenzoate?
The IUPAC name of [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 2,3-dimethoxybenzoate (CID 2153742) is [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 2,3-dimethoxybenzoate.
What is the SMILES notation for [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 2,3-dimethoxybenzoate?
The canonical SMILES for [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 2,3-dimethoxybenzoate is COc1cccc(C(=O)Oc2c(Sc3ccc(Cl)cc3)c(C)nn2-c2ccccc2)c1OC.
What is the InChIKey of [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 2,3-dimethoxybenzoate?
The InChIKey is WZASQJNBXHMCCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21ClN2O4S/c1-16-23(33-19-14-12-17(26)13-15-19)24(28(27-16)18-8-5-4-6-9-18)32-25(29)20-10-7-11-21(30-2)22(20)31-3/h4-15H,1-3H3.
What are the key properties of [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 2,3-dimethoxybenzoate?
[4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 2,3-dimethoxybenzoate has a molecular weight of 480.97 g/mol, XLogP of 6.22, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 2,3-dimethoxybenzoate is sourced from PubChem (CID 2153742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).