C15H15ClN4O2S2 — CID 2158344
N-(3-chloro-4-methylphenyl)-2-[(8-oxo-6,7-dihydro-5H-[1,3,4]thiadiazolo[3,2-a][1,3]diazepin-2-yl)sulfanyl]acetamide (PubChem CID 2158344) has the molecular formula C15H15ClN4O2S2 and a molecular weight of 382.90 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[(8-oxo-6,7-dihydro-5H-[1,3,4]thiadiazolo[3,2-a][1,3]diazepin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[(8-oxo-6,7-dihydro-5H-[1,3,4]thiadiazolo[3,2-a][1,3]diazepin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 2158344 |
| Molecular Formula | C15H15ClN4O2S2 |
| Molecular Weight | 382.90 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[(8-oxo-6,7-dihydro-5H-[1,3,4]thiadiazolo[3,2-a][1,3]diazepin-2-yl)sulfanyl]acetamide |
| SMILES | Cc1ccc(NC(=O)CSC2=NN3CCCC(=O)N=C3S2)cc1Cl |
| InChI | InChI=1S/C15H15ClN4O2S2/c1-9-4-5-10(7-11(9)16)17-13(22)8-23-15-19-20-6-2-3-12(21)18-14(20)24-15/h4-5,7H,2-3,6,8H2,1H3,(H,17,22) |
| InChIKey | IKMMXLROBAZDFA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.90 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |