C16H13NO4 — CID 2163239
N-(3-acetylphenyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 2163239) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is N-(3-acetylphenyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(3-acetylphenyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 2163239 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | N-(3-acetylphenyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C16H13NO4/c1-10(18)11-3-2-4-13(7-11)17-16(19)12-5-6-14-15(8-12)21-9-20-14/h2-8H,9H2,1H3,(H,17,19) |
| InChIKey | IEEXAUUKIUMLER-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |