C17H19BrFNO2 — CID 2163853
N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2-(4-fluorophenyl)ethanamine (PubChem CID 2163853) has the molecular formula C17H19BrFNO2 and a molecular weight of 368.25 g/mol. Its IUPAC name is N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2-(4-fluorophenyl)ethanamine.
| Compound Name | N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2-(4-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 2163853 |
| Molecular Formula | C17H19BrFNO2 |
| Molecular Weight | 368.25 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2-(4-fluorophenyl)ethanamine |
| SMILES | COc1cc(Br)c(CNCCc2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C17H19BrFNO2/c1-21-16-9-13(15(18)10-17(16)22-2)11-20-8-7-12-3-5-14(19)6-4-12/h3-6,9-10,20H,7-8,11H2,1-2H3 |
| InChIKey | XYJVFEGQASYIEC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.25 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|