C20H19N4O4S+ — CID 2164562
(5R)-11-methyl-5-[5-(2-nitrophenyl)furan-2-yl]-8-thia-4,6-diaza-11-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one (PubChem CID 2164562) has the molecular formula C20H19N4O4S+ and a molecular weight of 411.46 g/mol. Its IUPAC name is (5R)-11-methyl-5-[5-(2-nitrophenyl)furan-2-yl]-8-thia-4,6-diaza-11-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one.
| Compound Name | (5R)-11-methyl-5-[5-(2-nitrophenyl)furan-2-yl]-8-thia-4,6-diaza-11-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
|---|---|
| PubChem CID | 2164562 |
| Molecular Formula | C20H19N4O4S+ |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | (5R)-11-methyl-5-[5-(2-nitrophenyl)furan-2-yl]-8-thia-4,6-diaza-11-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
| SMILES | C[NH+]1CCc2c(sc3c2C(=O)N[C@@H](c2ccc(-c4ccccc4[N+](=O)[O-])o2)N3)C1 |
| InChI | InChI=1S/C20H18N4O4S/c1-23-9-8-12-16(10-23)29-20-17(12)19(25)21-18(22-20)15-7-6-14(28-15)11-4-2-3-5-13(11)24(26)27/h2-7,18,22H,8-10H2,1H3,(H,21,25)/p+1/t18-/m1/s1 |
| InChIKey | HQTSRCLUXKOYLF-GOSISDBHSA-O |
| XLogP | 2.34 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|