C23H32N3S+ — CID 21696
N,N-diethyl-2-[2-[4-(2-methylpropyl)phenyl]sulfanyl-3H-benzimidazol-1-ium-1-yl]ethanamine (PubChem CID 21696) has the molecular formula C23H32N3S+ and a molecular weight of 382.60 g/mol. Its IUPAC name is N,N-diethyl-2-[2-[4-(2-methylpropyl)phenyl]sulfanyl-3H-benzimidazol-1-ium-1-yl]ethanamine.
| Compound Name | N,N-diethyl-2-[2-[4-(2-methylpropyl)phenyl]sulfanyl-3H-benzimidazol-1-ium-1-yl]ethanamine |
|---|---|
| PubChem CID | 21696 |
| Molecular Formula | C23H32N3S+ |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | N,N-diethyl-2-[2-[4-(2-methylpropyl)phenyl]sulfanyl-3H-benzimidazol-1-ium-1-yl]ethanamine |
| SMILES | CCN(CC)CC[n+]1c(Sc2ccc(CC(C)C)cc2)[nH]c2ccccc21 |
| InChI | InChI=1S/C23H31N3S/c1-5-25(6-2)15-16-26-22-10-8-7-9-21(22)24-23(26)27-20-13-11-19(12-14-20)17-18(3)4/h7-14,18H,5-6,15-17H2,1-4H3/p+1 |
| InChIKey | JUSXHUJVFIMSSV-UHFFFAOYSA-O |
| XLogP | 5.15 |
| TPSA | 22.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|