C8H15NO — CID 21702842
1-Piperidinecarboxaldehyde, 3,4-dimethyl- (PubChem CID 21702842) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 3,4-dimethylpiperidine-1-carbaldehyde.
| Compound Name | 1-Piperidinecarboxaldehyde, 3,4-dimethyl- |
|---|---|
| PubChem CID | 21702842 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 3,4-dimethylpiperidine-1-carbaldehyde |
| SMILES | CC1CCN(CC1C)C=O |
| InChI | InChI=1S/C8H15NO/c1-7-3-4-9(6-10)5-8(7)2/h6-8H,3-5H2,1-2H3 |
| InChIKey | RGVAWGDYFIXCPU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | 124 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|